C29H24F3N5OS — CID 123720118
1-(2,6-dimethylphenyl)-3-[1-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]ethylideneamino]thiourea (PubChem CID 123720118) has the molecular formula C29H24F3N5OS and a molecular weight of 547.61 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[1-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]ethylideneamino]thiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[1-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 123720118 |
| Molecular Formula | C29H24F3N5OS |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[1-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]ethylideneamino]thiourea |
| SMILES | CC(=NNC(=S)Nc1c(C)cccc1C)c1ccc2c(ccc3c2ncn3-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C29H24F3N5OS/c1-17-5-4-6-18(2)26(17)34-28(39)36-35-19(3)20-7-13-24-21(15-20)8-14-25-27(24)33-16-37(25)22-9-11-23(12-10-22)38-29(30,31)32/h4-16H,1-3H3,(H2,34,36,39) |
| InChIKey | ADEJFLIQTLFXAL-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|