C31H26F3N3OS — CID 146809331
1-(2,6-dimethylphenyl)-3-[1-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]ethylideneamino]propane-2-thione (PubChem CID 146809331) has the molecular formula C31H26F3N3OS and a molecular weight of 545.63 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[1-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]ethylideneamino]propane-2-thione.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[1-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]ethylideneamino]propane-2-thione |
|---|---|
| PubChem CID | 146809331 |
| Molecular Formula | C31H26F3N3OS |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[1-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]ethylideneamino]propane-2-thione |
| SMILES | C/C(=N\CC(=S)Cc1c(C)cccc1C)c1ccc2c(ccc3c2ncn3-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C31H26F3N3OS/c1-19-5-4-6-20(2)28(19)16-26(39)17-35-21(3)22-7-13-27-23(15-22)8-14-29-30(27)36-18-37(29)24-9-11-25(12-10-24)38-31(32,33)34/h4-15,18H,16-17H2,1-3H3/b35-21+ |
| InChIKey | RZSYCJWLCOBKQA-XICOUIIWSA-N |
| XLogP | 8.12 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|