C30H24F3N3OS — CID 158180123
1-(2,6-dimethylphenyl)-3-[[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]propane-2-thione (PubChem CID 158180123) has the molecular formula C30H24F3N3OS and a molecular weight of 531.60 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]propane-2-thione.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]propane-2-thione |
|---|---|
| PubChem CID | 158180123 |
| Molecular Formula | C30H24F3N3OS |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]propane-2-thione |
| SMILES | Cc1cccc(C)c1CC(=S)C/N=C/c1ccc2c(ccc3c2ncn3-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C30H24F3N3OS/c1-19-4-3-5-20(2)27(19)15-25(38)17-34-16-21-6-12-26-22(14-21)7-13-28-29(26)35-18-36(28)23-8-10-24(11-9-23)37-30(31,32)33/h3-14,16,18H,15,17H2,1-2H3/b34-16+ |
| InChIKey | FYMGINLREAIEJL-AABVJFSESA-N |
| XLogP | 7.73 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|