C28H23F3N5O2S2+ — CID 121376610
methylidene-[(2-methyl-6-methylsulfinylphenyl)carbamothioylamino]-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]azanium (PubChem CID 121376610) has the molecular formula C28H23F3N5O2S2+ and a molecular weight of 582.65 g/mol. Its IUPAC name is methylidene-[(2-methyl-6-methylsulfinylphenyl)carbamothioylamino]-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]azanium.
| Compound Name | methylidene-[(2-methyl-6-methylsulfinylphenyl)carbamothioylamino]-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]azanium |
|---|---|
| PubChem CID | 121376610 |
| Molecular Formula | C28H23F3N5O2S2+ |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.12 |
| IUPAC Name | methylidene-[(2-methyl-6-methylsulfinylphenyl)carbamothioylamino]-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]azanium |
| SMILES | C=[N+](NC(=S)Nc1c(C)cccc1S(C)=O)c1ccc2c(ccc3c2ncn3-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C28H22F3N5O2S2/c1-17-5-4-6-24(40(3)37)25(17)33-27(39)34-35(2)20-10-13-22-18(15-20)7-14-23-26(22)32-16-36(23)19-8-11-21(12-9-19)38-28(29,30)31/h4-16H,2H2,1,3H3,(H-,33,34,39)/p+1 |
| InChIKey | KJNATIUDSOHBGN-UHFFFAOYSA-O |
| XLogP | 6.37 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|