C28H22F3N5OS — CID 86763359
1-(2,6-dimethylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea (PubChem CID 86763359) has the molecular formula C28H22F3N5OS and a molecular weight of 533.58 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 86763359 |
| Molecular Formula | C28H22F3N5OS |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)N/N=C/c1ccc2c(ccc3c2ncn3-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C28H22F3N5OS/c1-17-4-3-5-18(2)25(17)34-27(38)35-33-15-19-6-12-23-20(14-19)7-13-24-26(23)32-16-36(24)21-8-10-22(11-9-21)37-28(29,30)31/h3-16H,1-2H3,(H2,34,35,38)/b33-15+ |
| InChIKey | FNWAPJJGBJPHDO-ROPCREHHSA-N |
| XLogP | 7.01 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|