C25H19F3N4O3S — CID 122424189
1-(2,6-dimethylphenyl)-3-[(E)-[1,3-dioxo-2-[4-(trifluoromethoxy)phenyl]isoindol-5-yl]methylideneamino]thiourea (PubChem CID 122424189) has the molecular formula C25H19F3N4O3S and a molecular weight of 512.51 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(E)-[1,3-dioxo-2-[4-(trifluoromethoxy)phenyl]isoindol-5-yl]methylideneamino]thiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(E)-[1,3-dioxo-2-[4-(trifluoromethoxy)phenyl]isoindol-5-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 122424189 |
| Molecular Formula | C25H19F3N4O3S |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(E)-[1,3-dioxo-2-[4-(trifluoromethoxy)phenyl]isoindol-5-yl]methylideneamino]thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)N/N=C/c1ccc2c(c1)C(=O)N(c1ccc(OC(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C25H19F3N4O3S/c1-14-4-3-5-15(2)21(14)30-24(36)31-29-13-16-6-11-19-20(12-16)23(34)32(22(19)33)17-7-9-18(10-8-17)35-25(26,27)28/h3-13H,1-2H3,(H2,30,31,36)/b29-13+ |
| InChIKey | GJBRUHJPZAHHCR-VFLNYLIXSA-N |
| XLogP | 5.32 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|