C25H22N4O3S — CID 134163736
1-(2,6-dimethylphenyl)-3-[(E)-[2-(4-methoxyphenyl)-1,3-dioxoisoindol-5-yl]methylideneamino]thiourea (PubChem CID 134163736) has the molecular formula C25H22N4O3S and a molecular weight of 458.54 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(E)-[2-(4-methoxyphenyl)-1,3-dioxoisoindol-5-yl]methylideneamino]thiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(E)-[2-(4-methoxyphenyl)-1,3-dioxoisoindol-5-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 134163736 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(E)-[2-(4-methoxyphenyl)-1,3-dioxoisoindol-5-yl]methylideneamino]thiourea |
| SMILES | COc1ccc(N2C(=O)c3ccc(/C=N/NC(=S)Nc4c(C)cccc4C)cc3C2=O)cc1 |
| InChI | InChI=1S/C25H22N4O3S/c1-15-5-4-6-16(2)22(15)27-25(33)28-26-14-17-7-12-20-21(13-17)24(31)29(23(20)30)18-8-10-19(32-3)11-9-18/h4-14H,1-3H3,(H2,27,28,33)/b26-14+ |
| InChIKey | MUBHQCAYXXWSJN-VULFUBBASA-N |
| XLogP | 4.43 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|