C25H21F3N4O4 — CID 155149775
1-(2,6-dimethylphenyl)-3-[(E)-[1-hydroxy-3-oxo-2-[4-(trifluoromethoxy)phenyl]-1H-isoindol-5-yl]methylideneamino]urea (PubChem CID 155149775) has the molecular formula C25H21F3N4O4 and a molecular weight of 498.46 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(E)-[1-hydroxy-3-oxo-2-[4-(trifluoromethoxy)phenyl]-1H-isoindol-5-yl]methylideneamino]urea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(E)-[1-hydroxy-3-oxo-2-[4-(trifluoromethoxy)phenyl]-1H-isoindol-5-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 155149775 |
| Molecular Formula | C25H21F3N4O4 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(E)-[1-hydroxy-3-oxo-2-[4-(trifluoromethoxy)phenyl]-1H-isoindol-5-yl]methylideneamino]urea |
| SMILES | Cc1cccc(C)c1NC(=O)N/N=C/c1ccc2c(c1)C(=O)N(c1ccc(OC(F)(F)F)cc1)C2O |
| InChI | InChI=1S/C25H21F3N4O4/c1-14-4-3-5-15(2)21(14)30-24(35)31-29-13-16-6-11-19-20(12-16)23(34)32(22(19)33)17-7-9-18(10-8-17)36-25(26,27)28/h3-13,22,33H,1-2H3,(H2,30,31,35)/b29-13+ |
| InChIKey | LVOFLXHEHMROKX-VFLNYLIXSA-N |
| XLogP | 5.01 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|