C24H18F3N5O2 — CID 155149782
1-(2,6-dimethylphenyl)-3-[(E)-[2-[4-(trifluoromethoxy)phenyl]-7,8-didehydroimidazo[1,2-a]pyridin-6-yl]methylideneamino]urea (PubChem CID 155149782) has the molecular formula C24H18F3N5O2 and a molecular weight of 465.44 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(E)-[2-[4-(trifluoromethoxy)phenyl]-7,8-didehydroimidazo[1,2-a]pyridin-6-yl]methylideneamino]urea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(E)-[2-[4-(trifluoromethoxy)phenyl]-7,8-didehydroimidazo[1,2-a]pyridin-6-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 155149782 |
| Molecular Formula | C24H18F3N5O2 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(E)-[2-[4-(trifluoromethoxy)phenyl]-7,8-didehydroimidazo[1,2-a]pyridin-6-yl]methylideneamino]urea |
| SMILES | Cc1cccc(C)c1NC(=O)N/N=C/c1c#cc2nc(-c3ccc(OC(F)(F)F)cc3)cn2c1 |
| InChI | InChI=1S/C24H18F3N5O2/c1-15-4-3-5-16(2)22(15)30-23(33)31-28-12-17-6-11-21-29-20(14-32(21)13-17)18-7-9-19(10-8-18)34-24(25,26)27/h3-5,7-10,12-14H,1-2H3,(H2,30,31,33)/b28-12+ |
| InChIKey | DNJKZKSUXVPPLS-KVSWJAHQSA-N |
| XLogP | 5.27 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|