C18H21N3O3 — CID 77108051
1-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-3-(2,6-dimethylphenyl)urea (PubChem CID 77108051) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 77108051 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[(E)-(2,3-dimethoxyphenyl)methylideneamino]-3-(2,6-dimethylphenyl)urea |
| SMILES | COc1cccc(/C=N/NC(=O)Nc2c(C)cccc2C)c1OC |
| InChI | InChI=1S/C18H21N3O3/c1-12-7-5-8-13(2)16(12)20-18(22)21-19-11-14-9-6-10-15(23-3)17(14)24-4/h5-11H,1-4H3,(H2,20,21,22)/b19-11+ |
| InChIKey | IZBYOCKJPYHSRL-YBFXNURJSA-N |
| XLogP | 3.48 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|