C20H25N3O4 — CID 19169367
1-(4-butoxyphenyl)-3-[(2,3-dimethoxyphenyl)methylideneamino]urea (PubChem CID 19169367) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-[(2,3-dimethoxyphenyl)methylideneamino]urea.
| Compound Name | 1-(4-butoxyphenyl)-3-[(2,3-dimethoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 19169367 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-[(2,3-dimethoxyphenyl)methylideneamino]urea |
| SMILES | CCCCOc1ccc(NC(=O)NN=Cc2cccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C20H25N3O4/c1-4-5-13-27-17-11-9-16(10-12-17)22-20(24)23-21-14-15-7-6-8-18(25-2)19(15)26-3/h6-12,14H,4-5,13H2,1-3H3,(H2,22,23,24) |
| InChIKey | VAULJGQQKICRGF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|