C20H25N3O3 — CID 126027428
1-(2,3-dimethylphenyl)-3-[(E)-(3-methoxy-2-propan-2-yloxyphenyl)methylideneamino]urea (PubChem CID 126027428) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[(E)-(3-methoxy-2-propan-2-yloxyphenyl)methylideneamino]urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[(E)-(3-methoxy-2-propan-2-yloxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 126027428 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[(E)-(3-methoxy-2-propan-2-yloxyphenyl)methylideneamino]urea |
| SMILES | COc1cccc(/C=N/NC(=O)Nc2cccc(C)c2C)c1OC(C)C |
| InChI | InChI=1S/C20H25N3O3/c1-13(2)26-19-16(9-7-11-18(19)25-5)12-21-23-20(24)22-17-10-6-8-14(3)15(17)4/h6-13H,1-5H3,(H2,22,23,24)/b21-12+ |
| InChIKey | URMURTCVINXGIF-CIAFOILYSA-N |
| XLogP | 4.25 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|