C25H33N3O4 — CID 3270963
N-(2,3-dimethylphenyl)-N'-[(3-methoxy-2-pentoxyphenyl)methylideneamino]butanediamide (PubChem CID 3270963) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-N'-[(3-methoxy-2-pentoxyphenyl)methylideneamino]butanediamide.
| Compound Name | N-(2,3-dimethylphenyl)-N'-[(3-methoxy-2-pentoxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 3270963 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | N-(2,3-dimethylphenyl)-N'-[(3-methoxy-2-pentoxyphenyl)methylideneamino]butanediamide |
| SMILES | CCCCCOc1c(C=NNC(=O)CCC(=O)Nc2cccc(C)c2C)cccc1OC |
| InChI | InChI=1S/C25H33N3O4/c1-5-6-7-16-32-25-20(11-9-13-22(25)31-4)17-26-28-24(30)15-14-23(29)27-21-12-8-10-18(2)19(21)3/h8-13,17H,5-7,14-16H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | JBSYDAWIBBNYST-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|