C22H25Cl2N3O4 — CID 4019007
N-(3,4-dichlorophenyl)-N'-[(3-methoxy-2-pentoxyphenyl)methylideneamino]propanediamide (PubChem CID 4019007) has the molecular formula C22H25Cl2N3O4 and a molecular weight of 466.37 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N'-[(3-methoxy-2-pentoxyphenyl)methylideneamino]propanediamide.
| Compound Name | N-(3,4-dichlorophenyl)-N'-[(3-methoxy-2-pentoxyphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 4019007 |
| Molecular Formula | C22H25Cl2N3O4 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N'-[(3-methoxy-2-pentoxyphenyl)methylideneamino]propanediamide |
| SMILES | CCCCCOc1c(C=NNC(=O)CC(=O)Nc2ccc(Cl)c(Cl)c2)cccc1OC |
| InChI | InChI=1S/C22H25Cl2N3O4/c1-3-4-5-11-31-22-15(7-6-8-19(22)30-2)14-25-27-21(29)13-20(28)26-16-9-10-17(23)18(24)12-16/h6-10,12,14H,3-5,11,13H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | ZZLDONIJJLKGPE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|