C24H28F3N3O4 — CID 5239743
N'-[(3-methoxy-2-pentoxyphenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]butanediamide (PubChem CID 5239743) has the molecular formula C24H28F3N3O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is N'-[(3-methoxy-2-pentoxyphenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]butanediamide.
| Compound Name | N'-[(3-methoxy-2-pentoxyphenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]butanediamide |
|---|---|
| PubChem CID | 5239743 |
| Molecular Formula | C24H28F3N3O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N'-[(3-methoxy-2-pentoxyphenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]butanediamide |
| SMILES | CCCCCOc1c(C=NNC(=O)CCC(=O)Nc2cccc(C(F)(F)F)c2)cccc1OC |
| InChI | InChI=1S/C24H28F3N3O4/c1-3-4-5-14-34-23-17(8-6-11-20(23)33-2)16-28-30-22(32)13-12-21(31)29-19-10-7-9-18(15-19)24(25,26)27/h6-11,15-16H,3-5,12-14H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | IBDDAPCRUWPVTK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|