C27H23F3N4OS — CID 123377648
1-(2,6-dimethylphenyl)-3-[[4-[1-[4-(trifluoromethoxy)phenyl]pyrrol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 123377648) has the molecular formula C27H23F3N4OS and a molecular weight of 508.57 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[[4-[1-[4-(trifluoromethoxy)phenyl]pyrrol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[[4-[1-[4-(trifluoromethoxy)phenyl]pyrrol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 123377648 |
| Molecular Formula | C27H23F3N4OS |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[[4-[1-[4-(trifluoromethoxy)phenyl]pyrrol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)NN=Cc1ccc(-c2ccn(-c3ccc(OC(F)(F)F)cc3)c2)cc1 |
| InChI | InChI=1S/C27H23F3N4OS/c1-18-4-3-5-19(2)25(18)32-26(36)33-31-16-20-6-8-21(9-7-20)22-14-15-34(17-22)23-10-12-24(13-11-23)35-27(28,29)30/h3-17H,1-2H3,(H2,32,33,36) |
| InChIKey | FLTMZYGBBCJITB-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 50.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|