About 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea
1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 122284041) has the molecular formula C21H15F3N4O2
and a molecular weight of 412.37 g/mol. Its IUPAC name is 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea.
Molecular Properties
| Compound Name | 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea |
| PubChem CID | 122284041 |
| Molecular Formula | C21H15F3N4O2 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)Nc1ccc(-c2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C21H15F3N4O2/c22-21(23,24)30-17-10-8-16(9-11-17)26-20(29)25-15-6-4-14(5-7-15)18-13-28-12-2-1-3-19(28)27-18/h1-13H,(H2,25,26,29) |
| InChIKey | PNLGJRLTCCSAAS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea?
The IUPAC name of 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea (CID 122284041) is 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea.
What is the SMILES notation for 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea?
The canonical SMILES for 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea is O=C(Nc1ccc(OC(F)(F)F)cc1)Nc1ccc(-c2cn3ccccc3n2)cc1.
What is the InChIKey of 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea?
The InChIKey is PNLGJRLTCCSAAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F3N4O2/c22-21(23,24)30-17-10-8-16(9-11-17)26-20(29)25-15-6-4-14(5-7-15)18-13-28-12-2-1-3-19(28)27-18/h1-13H,(H2,25,26,29).
What are the key properties of 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea?
1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea has a molecular weight of 412.37 g/mol, XLogP of 5.54, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea is sourced from PubChem (CID 122284041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).