C17H16F3N5O — CID 111040176
2-(2-imidazo[1,2-a]pyridin-2-ylethyl)-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 111040176) has the molecular formula C17H16F3N5O and a molecular weight of 363.34 g/mol. Its IUPAC name is 2-(2-imidazo[1,2-a]pyridin-2-ylethyl)-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-(2-imidazo[1,2-a]pyridin-2-ylethyl)-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 111040176 |
| Molecular Formula | C17H16F3N5O |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-(2-imidazo[1,2-a]pyridin-2-ylethyl)-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N/C(=N\CCc1cn2ccccc2n1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3N5O/c18-17(19,20)26-14-6-4-12(5-7-14)24-16(21)22-9-8-13-11-25-10-2-1-3-15(25)23-13/h1-7,10-11H,8-9H2,(H3,21,22,24) |
| InChIKey | SUMWNNUYCDPIGM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|