C24H20F3N5O2 — CID 122424130
1-(2,6-dimethylphenyl)-3-[(E)-[1-[4-(trifluoromethoxy)phenyl]indazol-5-yl]methylideneamino]urea (PubChem CID 122424130) has the molecular formula C24H20F3N5O2 and a molecular weight of 467.45 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(E)-[1-[4-(trifluoromethoxy)phenyl]indazol-5-yl]methylideneamino]urea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(E)-[1-[4-(trifluoromethoxy)phenyl]indazol-5-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 122424130 |
| Molecular Formula | C24H20F3N5O2 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(E)-[1-[4-(trifluoromethoxy)phenyl]indazol-5-yl]methylideneamino]urea |
| SMILES | Cc1cccc(C)c1NC(=O)N/N=C/c1ccc2c(cnn2-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C24H20F3N5O2/c1-15-4-3-5-16(2)22(15)30-23(33)31-28-13-17-6-11-21-18(12-17)14-29-32(21)19-7-9-20(10-8-19)34-24(25,26)27/h3-14H,1-2H3,(H2,30,31,33)/b28-13+ |
| InChIKey | NBXSZKZURAGEOK-XODNFHPESA-N |
| XLogP | 5.70 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|