C27H21F3N4O — CID 150662541
2,6-dimethyl-N-[(Z)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]indazol-7-yl]methylideneamino]aniline (PubChem CID 150662541) has the molecular formula C27H21F3N4O and a molecular weight of 474.49 g/mol. Its IUPAC name is 2,6-dimethyl-N-[(Z)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]indazol-7-yl]methylideneamino]aniline.
| Compound Name | 2,6-dimethyl-N-[(Z)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]indazol-7-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 150662541 |
| Molecular Formula | C27H21F3N4O |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2,6-dimethyl-N-[(Z)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]indazol-7-yl]methylideneamino]aniline |
| SMILES | Cc1cccc(C)c1N/N=C\c1ccc2c(ccc3c2cnn3-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H21F3N4O/c1-17-4-3-5-18(2)26(17)33-31-15-19-6-12-23-20(14-19)7-13-25-24(23)16-32-34(25)21-8-10-22(11-9-21)35-27(28,29)30/h3-16,33H,1-2H3/b31-15- |
| InChIKey | JEELXYJSLFLYRL-BVMLUPFRSA-N |
| XLogP | 7.14 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|