C30H23F3N6OS — CID 121484980
3-(2,6-dimethylphenyl)-2-N-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]-1,3-thiazolidine-2,4-diimine (PubChem CID 121484980) has the molecular formula C30H23F3N6OS and a molecular weight of 572.62 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-2-N-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]-1,3-thiazolidine-2,4-diimine.
| Compound Name | 3-(2,6-dimethylphenyl)-2-N-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]-1,3-thiazolidine-2,4-diimine |
|---|---|
| PubChem CID | 121484980 |
| Molecular Formula | C30H23F3N6OS |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-2-N-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]-1,3-thiazolidine-2,4-diimine |
| SMILES | [H]/N=C1\CS/C(=N\N=C\c2ccc3c(ccc4c3ncn4-c3ccc(OC(F)(F)F)cc3)c2)N1c1c(C)cccc1C |
| InChI | InChI=1S/C30H23F3N6OS/c1-18-4-3-5-19(2)28(18)39-26(34)16-41-29(39)37-36-15-20-6-12-24-21(14-20)7-13-25-27(24)35-17-38(25)22-8-10-23(11-9-22)40-30(31,32)33/h3-15,17,34H,16H2,1-2H3/b34-26+,36-15+,37-29- |
| InChIKey | YTBMLJCTCUAREA-LIDYBCIYSA-N |
| XLogP | 7.61 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|