C28H23F3N6O2S — CID 77458059
3-(2,6-dimethylphenyl)-2-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazinan-4-one (PubChem CID 77458059) has the molecular formula C28H23F3N6O2S and a molecular weight of 564.59 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-2-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazinan-4-one.
| Compound Name | 3-(2,6-dimethylphenyl)-2-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 77458059 |
| Molecular Formula | C28H23F3N6O2S |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-2-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazinan-4-one |
| SMILES | Cc1cccc(C)c1N1C(=O)CCSC1=NN=Cc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C28H23F3N6O2S/c1-18-4-3-5-19(2)25(18)37-24(38)14-15-40-27(37)34-33-16-20-6-8-21(9-7-20)26-32-17-36(35-26)22-10-12-23(13-11-22)39-28(29,30)31/h3-13,16-17H,14-15H2,1-2H3 |
| InChIKey | XNIBMWXGBBQNSY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 84.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|