C28H24F3N7O2S — CID 172939896
1-[3-(2,6-dimethylphenyl)-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea (PubChem CID 172939896) has the molecular formula C28H24F3N7O2S and a molecular weight of 579.61 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylphenyl)-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea.
| Compound Name | 1-[3-(2,6-dimethylphenyl)-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 172939896 |
| Molecular Formula | C28H24F3N7O2S |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | 1-[3-(2,6-dimethylphenyl)-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea |
| SMILES | Cc1cccc(C)c1N1CCSC1=NC(=O)N/N=C/c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C28H24F3N7O2S/c1-18-4-3-5-19(2)24(18)37-14-15-41-27(37)34-26(39)35-33-16-20-6-8-21(9-7-20)25-32-17-38(36-25)22-10-12-23(13-11-22)40-28(29,30)31/h3-13,16-17H,14-15H2,1-2H3,(H,35,39)/b33-16+,34-27? |
| InChIKey | KXLBKJBLTNNSDA-VJKGHBGCSA-N |
| XLogP | 6.10 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|