C27H20F3N7O3S — CID 172944672
1-[3-(3-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea (PubChem CID 172944672) has the molecular formula C27H20F3N7O3S and a molecular weight of 579.56 g/mol. Its IUPAC name is 1-[3-(3-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea.
| Compound Name | 1-[3-(3-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 172944672 |
| Molecular Formula | C27H20F3N7O3S |
| Molecular Weight | 579.56 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | 1-[3-(3-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea |
| SMILES | Cc1cccc(N2C(=O)CSC2=NC(=O)N/N=C/c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C27H20F3N7O3S/c1-17-3-2-4-21(13-17)37-23(38)15-41-26(37)33-25(39)34-32-14-18-5-7-19(8-6-18)24-31-16-36(35-24)20-9-11-22(12-10-20)40-27(28,29)30/h2-14,16H,15H2,1H3,(H,34,39)/b32-14+,33-26? |
| InChIKey | ZDZQKCYADQMHOY-FHYXEVHUSA-N |
| XLogP | 5.32 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|