C28H22F3N7O4S — CID 134413400
(1Z)-1-[3-(4-methoxy-2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea (PubChem CID 134413400) has the molecular formula C28H22F3N7O4S and a molecular weight of 609.59 g/mol. Its IUPAC name is (1Z)-1-[3-(4-methoxy-2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea.
| Compound Name | (1Z)-1-[3-(4-methoxy-2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 134413400 |
| Molecular Formula | C28H22F3N7O4S |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | (1Z)-1-[3-(4-methoxy-2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea |
| SMILES | COc1ccc(N2C(=O)CS/C2=N\C(=O)N/N=C/c2cccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)c2)c(C)c1 |
| InChI | InChI=1S/C28H22F3N7O4S/c1-17-12-22(41-2)10-11-23(17)38-24(39)15-43-27(38)34-26(40)35-33-14-18-4-3-5-19(13-18)25-32-16-37(36-25)20-6-8-21(9-7-20)42-28(29,30)31/h3-14,16H,15H2,1-2H3,(H,35,40)/b33-14+,34-27- |
| InChIKey | YUDXBWDWOBOGFQ-UXKOMZIVSA-N |
| XLogP | 5.33 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|