C29H24F3N7O2S2 — CID 172961621
1-[3-(2-ethyl-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 172961621) has the molecular formula C29H24F3N7O2S2 and a molecular weight of 623.69 g/mol. Its IUPAC name is 1-[3-(2-ethyl-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-[3-(2-ethyl-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 172961621 |
| Molecular Formula | C29H24F3N7O2S2 |
| Molecular Weight | 623.69 g/mol |
| Exact Mass | 623.14 |
| IUPAC Name | 1-[3-(2-ethyl-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | CCc1cccc(C)c1N1C(=O)CSC1=NC(=S)N/N=C/c1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C29H24F3N7O2S2/c1-3-20-8-4-6-18(2)25(20)39-24(40)16-43-28(39)35-27(42)36-34-15-19-7-5-9-21(14-19)26-33-17-38(37-26)22-10-12-23(13-11-22)41-29(30,31)32/h4-15,17H,3,16H2,1-2H3,(H,36,42)/b34-15+,35-28? |
| InChIKey | KBVKWOTXWSMXSW-CFEKJNOVSA-N |
| XLogP | 6.05 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|