C30H28F3N7O2S2 — CID 171925892
1-[3-(2-ethyl-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylamino]thiourea (PubChem CID 171925892) has the molecular formula C30H28F3N7O2S2 and a molecular weight of 639.73 g/mol. Its IUPAC name is 1-[3-(2-ethyl-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylamino]thiourea.
| Compound Name | 1-[3-(2-ethyl-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylamino]thiourea |
|---|---|
| PubChem CID | 171925892 |
| Molecular Formula | C30H28F3N7O2S2 |
| Molecular Weight | 639.73 g/mol |
| Exact Mass | 639.17 |
| IUPAC Name | 1-[3-(2-ethyl-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylamino]thiourea |
| SMILES | CCc1cccc(C)c1N1C(=O)CSC1=NC(=S)NNC(C)c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C30H28F3N7O2S2/c1-4-20-7-5-6-18(2)26(20)40-25(41)16-44-29(40)35-28(43)37-36-19(3)21-8-10-22(11-9-21)27-34-17-39(38-27)23-12-14-24(15-13-23)42-30(31,32)33/h5-15,17,19,36H,4,16H2,1-3H3,(H,37,43) |
| InChIKey | QRYHLLBAPWMEGT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.73 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|