C31H28F3N5O3S — CID 153124702
N-[3-(2,6-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentanamide (PubChem CID 153124702) has the molecular formula C31H28F3N5O3S and a molecular weight of 607.66 g/mol. Its IUPAC name is N-[3-(2,6-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentanamide.
| Compound Name | N-[3-(2,6-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentanamide |
|---|---|
| PubChem CID | 153124702 |
| Molecular Formula | C31H28F3N5O3S |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | N-[3-(2,6-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentanamide |
| SMILES | Cc1cccc(C)c1N1C(=O)CS/C1=N\C(=O)CCC(C)c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C31H28F3N5O3S/c1-19(7-16-26(40)36-30-39(27(41)17-43-30)28-20(2)5-4-6-21(28)3)22-8-10-23(11-9-22)29-35-18-38(37-29)24-12-14-25(15-13-24)42-31(32,33)34/h4-6,8-15,18-19H,7,16-17H2,1-3H3/b36-30- |
| InChIKey | VVOJYYSQWPXOJN-BBTNWVSFSA-N |
| XLogP | 7.00 |
| TPSA | 89.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|