C30H25F5N6O3S — CID 123191459
1-[1,2-difluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea (PubChem CID 123191459) has the molecular formula C30H25F5N6O3S and a molecular weight of 644.63 g/mol. Its IUPAC name is 1-[1,2-difluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | 1-[1,2-difluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 123191459 |
| Molecular Formula | C30H25F5N6O3S |
| Molecular Weight | 644.63 g/mol |
| Exact Mass | 644.16 |
| IUPAC Name | 1-[1,2-difluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1cc(C)c(N2C(=O)CSC2=NC(=O)NC(F)C(F)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C30H25F5N6O3S/c1-16-12-17(2)25(18(3)13-16)41-23(42)14-45-29(41)38-28(43)37-26(32)24(31)19-4-6-20(7-5-19)27-36-15-40(39-27)21-8-10-22(11-9-21)44-30(33,34)35/h4-13,15,24,26H,14H2,1-3H3,(H,37,43) |
| InChIKey | FFKTYRHDGIEGIH-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.63 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|