C38H33F3N6O5S — CID 157237964
benzyl N-[3-oxo-3-[[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]amino]-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]carbamate (PubChem CID 157237964) has the molecular formula C38H33F3N6O5S and a molecular weight of 742.78 g/mol. Its IUPAC name is benzyl N-[3-oxo-3-[[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]amino]-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]carbamate.
| Compound Name | benzyl N-[3-oxo-3-[[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]amino]-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 157237964 |
| Molecular Formula | C38H33F3N6O5S |
| Molecular Weight | 742.78 g/mol |
| Exact Mass | 742.22 |
| IUPAC Name | benzyl N-[3-oxo-3-[[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]amino]-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]carbamate |
| SMILES | Cc1cc(C)c(N2C(=O)CS/C2=N\C(=O)CC(NC(=O)OCc2ccccc2)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C38H33F3N6O5S/c1-23-17-24(2)34(25(3)18-23)47-33(49)21-53-36(47)44-32(48)19-31(43-37(50)51-20-26-7-5-4-6-8-26)27-9-11-28(12-10-27)35-42-22-46(45-35)29-13-15-30(16-14-29)52-38(39,40)41/h4-18,22,31H,19-21H2,1-3H3,(H,43,50)/b44-36- |
| InChIKey | AUWDPEJMSWVFQP-XIPYOLKMSA-N |
| XLogP | 7.78 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.78 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|