C30H24F4N6O3S — CID 90438973
(3Z)-1-[(Z)-2-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea (PubChem CID 90438973) has the molecular formula C30H24F4N6O3S and a molecular weight of 624.62 g/mol. Its IUPAC name is (3Z)-1-[(Z)-2-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[(Z)-2-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 90438973 |
| Molecular Formula | C30H24F4N6O3S |
| Molecular Weight | 624.62 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | (3Z)-1-[(Z)-2-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[4-oxo-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1cc(C)c(N2C(=O)CS/C2=N\C(=O)N/C=C(\F)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C30H24F4N6O3S/c1-17-12-18(2)26(19(3)13-17)40-25(41)15-44-29(40)37-28(42)35-14-24(31)20-4-6-21(7-5-20)27-36-16-39(38-27)22-8-10-23(11-9-22)43-30(32,33)34/h4-14,16H,15H2,1-3H3,(H,35,42)/b24-14-,37-29- |
| InChIKey | SNKHSMVEPQJOKE-LCIKCAJUSA-N |
| XLogP | 6.87 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.62 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|