C30H22F3N7O3S — CID 90438558
(3Z)-1-[(Z)-2-cyano-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 90438558) has the molecular formula C30H22F3N7O3S and a molecular weight of 617.61 g/mol. Its IUPAC name is (3Z)-1-[(Z)-2-cyano-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[(Z)-2-cyano-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 90438558 |
| Molecular Formula | C30H22F3N7O3S |
| Molecular Weight | 617.61 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | (3Z)-1-[(Z)-2-cyano-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | CCc1ccccc1N1C(=O)CS/C1=N\C(=O)N/C=C(\C#N)c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C30H22F3N7O3S/c1-2-19-5-3-4-6-25(19)40-26(41)17-44-29(40)37-28(42)35-16-22(15-34)20-7-9-21(10-8-20)27-36-18-39(38-27)23-11-13-24(14-12-23)43-30(31,32)33/h3-14,16,18H,2,17H2,1H3,(H,35,42)/b22-16+,37-29- |
| InChIKey | RDWPQHPQQRZKEI-MYQLNSHCSA-N |
| XLogP | 6.11 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|