C29H25F3N6O2S2 — CID 154023062
1-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]thiourea (PubChem CID 154023062) has the molecular formula C29H25F3N6O2S2 and a molecular weight of 610.69 g/mol. Its IUPAC name is 1-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]thiourea.
| Compound Name | 1-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 154023062 |
| Molecular Formula | C29H25F3N6O2S2 |
| Molecular Weight | 610.69 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | 1-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]thiourea |
| SMILES | CCc1ccccc1N1C(=O)CSC1=NC(=S)NCCc1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C29H25F3N6O2S2/c1-2-20-7-3-4-9-24(20)38-25(39)17-42-28(38)35-27(41)33-15-14-19-6-5-8-21(16-19)26-34-18-37(36-26)22-10-12-23(13-11-22)40-29(30,31)32/h3-13,16,18H,2,14-15,17H2,1H3,(H,33,41) |
| InChIKey | DHKONDPTBHEPCI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.69 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|