C32H31F3N6O2S2 — CID 154023077
1-[3-(2-ethyl-5-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]thiourea (PubChem CID 154023077) has the molecular formula C32H31F3N6O2S2 and a molecular weight of 652.77 g/mol. Its IUPAC name is 1-[3-(2-ethyl-5-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]thiourea.
| Compound Name | 1-[3-(2-ethyl-5-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]thiourea |
|---|---|
| PubChem CID | 154023077 |
| Molecular Formula | C32H31F3N6O2S2 |
| Molecular Weight | 652.77 g/mol |
| Exact Mass | 652.19 |
| IUPAC Name | 1-[3-(2-ethyl-5-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]thiourea |
| SMILES | CCc1ccc(C)cc1N1C(=O)CSC1=NC(=S)NCCCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C32H31F3N6O2S2/c1-3-23-10-7-21(2)18-27(23)41-28(42)19-45-31(41)38-30(44)36-17-5-4-6-22-8-11-24(12-9-22)29-37-20-40(39-29)25-13-15-26(16-14-25)43-32(33,34)35/h7-16,18,20H,3-6,17,19H2,1-2H3,(H,36,44) |
| InChIKey | YWGFALOLKYQLBX-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.77 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|