C32H30F4N6O2S2 — CID 134486966
(1Z)-1-[3-(4-fluoro-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]thiourea (PubChem CID 134486966) has the molecular formula C32H30F4N6O2S2 and a molecular weight of 670.76 g/mol. Its IUPAC name is (1Z)-1-[3-(4-fluoro-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]thiourea.
| Compound Name | (1Z)-1-[3-(4-fluoro-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]thiourea |
|---|---|
| PubChem CID | 134486966 |
| Molecular Formula | C32H30F4N6O2S2 |
| Molecular Weight | 670.76 g/mol |
| Exact Mass | 670.18 |
| IUPAC Name | (1Z)-1-[3-(4-fluoro-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]thiourea |
| SMILES | CC(C)c1cc(F)ccc1N1C(=O)CS/C1=N\C(=S)NCCCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C32H30F4N6O2S2/c1-20(2)26-17-23(33)10-15-27(26)42-28(43)18-46-31(42)39-30(45)37-16-4-3-5-21-6-8-22(9-7-21)29-38-19-41(40-29)24-11-13-25(14-12-24)44-32(34,35)36/h6-15,17,19-20H,3-5,16,18H2,1-2H3,(H,37,45)/b39-31- |
| InChIKey | KSMOVVDQSJPVMV-RZLPTWENSA-N |
| XLogP | 7.43 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.76 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|