C33H33F3N6O3S2 — CID 171925457
1-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]thiourea (PubChem CID 171925457) has the molecular formula C33H33F3N6O3S2 and a molecular weight of 682.79 g/mol. Its IUPAC name is 1-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]thiourea.
| Compound Name | 1-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]thiourea |
|---|---|
| PubChem CID | 171925457 |
| Molecular Formula | C33H33F3N6O3S2 |
| Molecular Weight | 682.79 g/mol |
| Exact Mass | 682.20 |
| IUPAC Name | 1-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]thiourea |
| SMILES | COc1ccc(C(C)C)c(N2C(=O)CSC2=NC(=S)NCCCCc2cccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)c2)c1 |
| InChI | InChI=1S/C33H33F3N6O3S2/c1-21(2)27-15-14-26(44-3)18-28(27)42-29(43)19-47-32(42)39-31(46)37-16-5-4-7-22-8-6-9-23(17-22)30-38-20-41(40-30)24-10-12-25(13-11-24)45-33(34,35)36/h6,8-15,17-18,20-21H,4-5,7,16,19H2,1-3H3,(H,37,46) |
| InChIKey | BMWMPQFBEXPAGH-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.79 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|