C34H34F3N5O2S2 — CID 147874278
N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-6-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexanethioamide (PubChem CID 147874278) has the molecular formula C34H34F3N5O2S2 and a molecular weight of 665.81 g/mol. Its IUPAC name is N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-6-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexanethioamide.
| Compound Name | N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-6-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexanethioamide |
|---|---|
| PubChem CID | 147874278 |
| Molecular Formula | C34H34F3N5O2S2 |
| Molecular Weight | 665.81 g/mol |
| Exact Mass | 665.21 |
| IUPAC Name | N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-6-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexanethioamide |
| SMILES | Cc1ccc(C(C)C)c(N2C(=O)CS/C2=N\C(=S)CCCCCc2cccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)c2)c1 |
| InChI | InChI=1S/C34H34F3N5O2S2/c1-22(2)28-17-12-23(3)18-29(28)42-31(43)20-46-33(42)39-30(45)11-6-4-5-8-24-9-7-10-25(19-24)32-38-21-41(40-32)26-13-15-27(16-14-26)44-34(35,36)37/h7,9-10,12-19,21-22H,4-6,8,11,20H2,1-3H3/b39-33- |
| InChIKey | HZFCOHNMUYKIQW-SCURRHDHSA-N |
| XLogP | 8.83 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.81 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|