C31H28F3N5O2S2 — CID 160567000
N-[3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-6-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexanethioamide (PubChem CID 160567000) has the molecular formula C31H28F3N5O2S2 and a molecular weight of 623.73 g/mol. Its IUPAC name is N-[3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-6-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexanethioamide.
| Compound Name | N-[3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-6-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexanethioamide |
|---|---|
| PubChem CID | 160567000 |
| Molecular Formula | C31H28F3N5O2S2 |
| Molecular Weight | 623.73 g/mol |
| Exact Mass | 623.16 |
| IUPAC Name | N-[3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-6-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexanethioamide |
| SMILES | Cc1ccccc1N1C(=O)CS/C1=N\C(=S)CCCCCc1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C31H28F3N5O2S2/c1-21-8-5-6-12-26(21)39-28(40)19-43-30(39)36-27(42)13-4-2-3-9-22-10-7-11-23(18-22)29-35-20-38(37-29)24-14-16-25(17-15-24)41-31(32,33)34/h5-8,10-12,14-18,20H,2-4,9,13,19H2,1H3/b36-30- |
| InChIKey | RAAZEPWJPGNOEV-BBTNWVSFSA-N |
| XLogP | 7.71 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.73 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|