C31H28F3N5O3S — CID 146762061
N-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butanamide (PubChem CID 146762061) has the molecular formula C31H28F3N5O3S and a molecular weight of 607.66 g/mol. Its IUPAC name is N-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butanamide.
| Compound Name | N-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 146762061 |
| Molecular Formula | C31H28F3N5O3S |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | N-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butanamide |
| SMILES | CC(C)c1ccccc1N1C(=O)CS/C1=N\C(=O)CCCc1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C31H28F3N5O3S/c1-20(2)25-10-3-4-11-26(25)39-28(41)18-43-30(39)36-27(40)12-6-8-21-7-5-9-22(17-21)29-35-19-38(37-29)23-13-15-24(16-14-23)42-31(32,33)34/h3-5,7,9-11,13-17,19-20H,6,8,12,18H2,1-2H3/b36-30- |
| InChIKey | RPPXKLIDKJNIIJ-BBTNWVSFSA-N |
| XLogP | 6.94 |
| TPSA | 89.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|