C32H30F3N5O2S2 — CID 160954254
N-[3-(2,6-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-6-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexanethioamide (PubChem CID 160954254) has the molecular formula C32H30F3N5O2S2 and a molecular weight of 637.75 g/mol. Its IUPAC name is N-[3-(2,6-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-6-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexanethioamide.
| Compound Name | N-[3-(2,6-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-6-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexanethioamide |
|---|---|
| PubChem CID | 160954254 |
| Molecular Formula | C32H30F3N5O2S2 |
| Molecular Weight | 637.75 g/mol |
| Exact Mass | 637.18 |
| IUPAC Name | N-[3-(2,6-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-6-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexanethioamide |
| SMILES | Cc1cccc(C)c1N1C(=O)CS/C1=N\C(=S)CCCCCc1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C32H30F3N5O2S2/c1-21-8-6-9-22(2)29(21)40-28(41)19-44-31(40)37-27(43)13-5-3-4-10-23-11-7-12-24(18-23)30-36-20-39(38-30)25-14-16-26(17-15-25)42-32(33,34)35/h6-9,11-12,14-18,20H,3-5,10,13,19H2,1-2H3/b37-31- |
| InChIKey | SWEAQNZXTHMCSJ-OXKNFPIISA-N |
| XLogP | 8.02 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.75 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|