C31H29F3N6O3S — CID 90442870
(1Z)-1-[3-(2,5-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea (PubChem CID 90442870) has the molecular formula C31H29F3N6O3S and a molecular weight of 622.67 g/mol. Its IUPAC name is (1Z)-1-[3-(2,5-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea.
| Compound Name | (1Z)-1-[3-(2,5-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
|---|---|
| PubChem CID | 90442870 |
| Molecular Formula | C31H29F3N6O3S |
| Molecular Weight | 622.67 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | (1Z)-1-[3-(2,5-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
| SMILES | Cc1ccc(C)c(N2C(=O)CS/C2=N\C(=O)NCCCCc2cccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)c2)c1 |
| InChI | InChI=1S/C31H29F3N6O3S/c1-20-9-10-21(2)26(16-20)40-27(41)18-44-30(40)37-29(42)35-15-4-3-6-22-7-5-8-23(17-22)28-36-19-39(38-28)24-11-13-25(14-12-24)43-31(32,33)34/h5,7-14,16-17,19H,3-4,6,15,18H2,1-2H3,(H,35,42)/b37-30- |
| InChIKey | YRYYVZNQRSFSGD-ONQIKCEGSA-N |
| XLogP | 6.62 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.67 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|