C31H29F3N6O3S — CID 123718531
1-[3-(5-methyl-2-propylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]urea (PubChem CID 123718531) has the molecular formula C31H29F3N6O3S and a molecular weight of 622.67 g/mol. Its IUPAC name is 1-[3-(5-methyl-2-propylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]urea.
| Compound Name | 1-[3-(5-methyl-2-propylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]urea |
|---|---|
| PubChem CID | 123718531 |
| Molecular Formula | C31H29F3N6O3S |
| Molecular Weight | 622.67 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | 1-[3-(5-methyl-2-propylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]urea |
| SMILES | CCCc1ccc(C)cc1N1C(=O)CSC1=NC(=O)NCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C31H29F3N6O3S/c1-3-4-22-8-5-20(2)17-26(22)40-27(41)18-44-30(40)37-29(42)35-16-15-21-6-9-23(10-7-21)28-36-19-39(38-28)24-11-13-25(14-12-24)43-31(32,33)34/h5-14,17,19H,3-4,15-16,18H2,1-2H3,(H,35,42) |
| InChIKey | RTYLOKNPHLCYOJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|