C32H33F3N6O3S — CID 131991910
(2Z)-2-[hydroxy-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propylamino]methyl]imino-3-(5-methyl-2-propylphenyl)-1,3-thiazolidin-4-one (PubChem CID 131991910) has the molecular formula C32H33F3N6O3S and a molecular weight of 638.72 g/mol. Its IUPAC name is (2Z)-2-[hydroxy-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propylamino]methyl]imino-3-(5-methyl-2-propylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[hydroxy-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propylamino]methyl]imino-3-(5-methyl-2-propylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 131991910 |
| Molecular Formula | C32H33F3N6O3S |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | (2Z)-2-[hydroxy-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propylamino]methyl]imino-3-(5-methyl-2-propylphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCCc1ccc(C)cc1N1C(=O)CS/C1=N\C(O)NCCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C32H33F3N6O3S/c1-3-5-23-10-7-21(2)18-27(23)41-28(42)19-45-31(41)38-30(43)36-17-4-6-22-8-11-24(12-9-22)29-37-20-40(39-29)25-13-15-26(16-14-25)44-32(33,34)35/h7-16,18,20,30,36,43H,3-6,17,19H2,1-2H3/b38-31- |
| InChIKey | ISBMTPREBPLMOD-NXKIGICWSA-N |
| XLogP | 6.03 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|