C31H31F3N6O3S — CID 129294687
(2Z)-3-(2,4-dimethylphenyl)-2-[hydroxy-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butylamino]methyl]imino-1,3-thiazolidin-4-one (PubChem CID 129294687) has the molecular formula C31H31F3N6O3S and a molecular weight of 624.69 g/mol. Its IUPAC name is (2Z)-3-(2,4-dimethylphenyl)-2-[hydroxy-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butylamino]methyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-3-(2,4-dimethylphenyl)-2-[hydroxy-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butylamino]methyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 129294687 |
| Molecular Formula | C31H31F3N6O3S |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | (2Z)-3-(2,4-dimethylphenyl)-2-[hydroxy-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butylamino]methyl]imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)CS/C2=N\C(O)NCCCCc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C31H31F3N6O3S/c1-20-6-15-26(21(2)17-20)40-27(41)18-44-30(40)37-29(42)35-16-4-3-5-22-7-9-23(10-8-22)28-36-19-39(38-28)24-11-13-25(14-12-24)43-31(32,33)34/h6-15,17,19,29,35,42H,3-5,16,18H2,1-2H3/b37-30- |
| InChIKey | BYSXQJHFMJWCAQ-ONQIKCEGSA-N |
| XLogP | 5.77 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|