C30H27F3N6O2S2 — CID 147503742
1-[3-(2-ethyl-4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]thiourea (PubChem CID 147503742) has the molecular formula C30H27F3N6O2S2 and a molecular weight of 624.71 g/mol. Its IUPAC name is 1-[3-(2-ethyl-4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]thiourea.
| Compound Name | 1-[3-(2-ethyl-4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 147503742 |
| Molecular Formula | C30H27F3N6O2S2 |
| Molecular Weight | 624.71 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | 1-[3-(2-ethyl-4-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]thiourea |
| SMILES | CCc1cc(C)ccc1N1C(=O)CSC1=NC(=S)NCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C30H27F3N6O2S2/c1-3-21-16-19(2)4-13-25(21)39-26(40)17-43-29(39)36-28(42)34-15-14-20-5-7-22(8-6-20)27-35-18-38(37-27)23-9-11-24(12-10-23)41-30(31,32)33/h4-13,16,18H,3,14-15,17H2,1-2H3,(H,34,42) |
| InChIKey | FHXWGVOXWUESPR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.71 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|