C30H29F3N6O3S — CID 174146371
3-(2,5-dimethylphenyl)-2-[hydroxy-[3-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propylamino]methyl]imino-1,3-thiazolidin-4-one (PubChem CID 174146371) has the molecular formula C30H29F3N6O3S and a molecular weight of 610.66 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-2-[hydroxy-[3-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propylamino]methyl]imino-1,3-thiazolidin-4-one.
| Compound Name | 3-(2,5-dimethylphenyl)-2-[hydroxy-[3-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propylamino]methyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 174146371 |
| Molecular Formula | C30H29F3N6O3S |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-2-[hydroxy-[3-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propylamino]methyl]imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C)c(N2C(=O)CSC2=NC(O)NCCCc2cccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)c2)c1 |
| InChI | InChI=1S/C30H29F3N6O3S/c1-19-8-9-20(2)25(15-19)39-26(40)17-43-29(39)36-28(41)34-14-4-6-21-5-3-7-22(16-21)27-35-18-38(37-27)23-10-12-24(13-11-23)42-30(31,32)33/h3,5,7-13,15-16,18,28,34,41H,4,6,14,17H2,1-2H3 |
| InChIKey | QDZYDXKJTURACU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|