C33H32F3N5OS2 — CID 158721650
N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-5-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]pentanethioamide (PubChem CID 158721650) has the molecular formula C33H32F3N5OS2 and a molecular weight of 635.78 g/mol. Its IUPAC name is N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-5-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]pentanethioamide.
| Compound Name | N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-5-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]pentanethioamide |
|---|---|
| PubChem CID | 158721650 |
| Molecular Formula | C33H32F3N5OS2 |
| Molecular Weight | 635.78 g/mol |
| Exact Mass | 635.20 |
| IUPAC Name | N-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-5-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]pentanethioamide |
| SMILES | Cc1ccc(C(C)C)c(N2C(=O)CS/C2=N\C(=S)CCCCc2ccc(-c3ncn(-c4ccc(C(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C33H32F3N5OS2/c1-21(2)27-17-8-22(3)18-28(27)41-30(42)19-44-32(41)38-29(43)7-5-4-6-23-9-11-24(12-10-23)31-37-20-40(39-31)26-15-13-25(14-16-26)33(34,35)36/h8-18,20-21H,4-7,19H2,1-3H3/b38-32- |
| InChIKey | IJZKSDFKBAAPCI-IFZQRFIDSA-N |
| XLogP | 8.56 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.78 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|