C31H28F3N7O3S2 — CID 134459043
[[[(Z)-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamothioyl]amino]-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]carbamic acid (PubChem CID 134459043) has the molecular formula C31H28F3N7O3S2 and a molecular weight of 667.74 g/mol. Its IUPAC name is [[[(Z)-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamothioyl]amino]-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]carbamic acid.
| Compound Name | [[[(Z)-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamothioyl]amino]-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]carbamic acid |
|---|---|
| PubChem CID | 134459043 |
| Molecular Formula | C31H28F3N7O3S2 |
| Molecular Weight | 667.74 g/mol |
| Exact Mass | 667.16 |
| IUPAC Name | [[[(Z)-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamothioyl]amino]-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]carbamic acid |
| SMILES | Cc1ccc(C(C)C)c(N2C(=O)CS/C2=N\C(=S)NC(NC(=O)O)c2ccc(-c3ncn(-c4ccc(C(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C31H28F3N7O3S2/c1-17(2)23-13-4-18(3)14-24(23)41-25(42)15-46-29(41)38-28(45)36-27(37-30(43)44)20-7-5-19(6-8-20)26-35-16-40(39-26)22-11-9-21(10-12-22)31(32,33)34/h4-14,16-17,27,37H,15H2,1-3H3,(H,36,45)(H,43,44)/b38-29- |
| InChIKey | OISSIVDIAZUXGZ-ZDNCSJAVSA-N |
| XLogP | 6.66 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.74 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|