C31H28F3N7O3S2 — CID 154036527
methyl N-[[[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]carbamothioylamino]-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]carbamate (PubChem CID 154036527) has the molecular formula C31H28F3N7O3S2 and a molecular weight of 667.74 g/mol. Its IUPAC name is methyl N-[[[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]carbamothioylamino]-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]carbamate.
| Compound Name | methyl N-[[[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]carbamothioylamino]-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 154036527 |
| Molecular Formula | C31H28F3N7O3S2 |
| Molecular Weight | 667.74 g/mol |
| Exact Mass | 667.16 |
| IUPAC Name | methyl N-[[[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]carbamothioylamino]-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]carbamate |
| SMILES | COC(=O)NC(NC(=S)N=C1SCC(=O)N1c1ccccc1C(C)C)c1ccc(-c2ncn(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C31H28F3N7O3S2/c1-18(2)23-6-4-5-7-24(23)41-25(42)16-46-29(41)38-28(45)36-27(37-30(43)44-3)20-10-8-19(9-11-20)26-35-17-40(39-26)22-14-12-21(13-15-22)31(32,33)34/h4-15,17-18,27H,16H2,1-3H3,(H,36,45)(H,37,43) |
| InChIKey | IADHTMAFOHKPCA-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.74 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|