C30H25F3N6O3S — CID 90442799
(1Z)-1-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]urea (PubChem CID 90442799) has the molecular formula C30H25F3N6O3S and a molecular weight of 606.63 g/mol. Its IUPAC name is (1Z)-1-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]urea.
| Compound Name | (1Z)-1-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]urea |
|---|---|
| PubChem CID | 90442799 |
| Molecular Formula | C30H25F3N6O3S |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | (1Z)-1-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]urea |
| SMILES | CCc1ccccc1N1C(=O)CS/C1=N\C(=O)NC1CC1c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C30H25F3N6O3S/c1-2-18-5-3-4-6-25(18)39-26(40)16-43-29(39)36-28(41)35-24-15-23(24)19-7-9-20(10-8-19)27-34-17-38(37-27)21-11-13-22(14-12-21)42-30(31,32)33/h3-14,17,23-24H,2,15-16H2,1H3,(H,35,41)/b36-29- |
| InChIKey | LTPHYXXQQIOMBJ-JTHRFTPNSA-N |
| XLogP | 6.10 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|